C12H16N2O3 — CID 82496759
6-[1-hydroxy-3-(methylamino)propyl]-4H-1,4-benzoxazin-3-one (PubChem CID 82496759) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 6-[1-hydroxy-3-(methylamino)propyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[1-hydroxy-3-(methylamino)propyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82496759 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 6-[1-hydroxy-3-(methylamino)propyl]-4H-1,4-benzoxazin-3-one |
| SMILES | CNCCC(O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C12H16N2O3/c1-13-5-4-10(15)8-2-3-11-9(6-8)14-12(16)7-17-11/h2-3,6,10,13,15H,4-5,7H2,1H3,(H,14,16) |
| InChIKey | AHBZVEIXKUWIDF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |