C15H20N2O3 — CID 82216271
6-(1-hydroxy-2-piperidin-1-ylethyl)-4H-1,4-benzoxazin-3-one (PubChem CID 82216271) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 6-(1-hydroxy-2-piperidin-1-ylethyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(1-hydroxy-2-piperidin-1-ylethyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82216271 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 6-(1-hydroxy-2-piperidin-1-ylethyl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(C(O)CN3CCCCC3)cc2N1 |
| InChI | InChI=1S/C15H20N2O3/c18-13(9-17-6-2-1-3-7-17)11-4-5-14-12(8-11)16-15(19)10-20-14/h4-5,8,13,18H,1-3,6-7,9-10H2,(H,16,19) |
| InChIKey | ALYPANYTFMYVRU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |