C11H12N2O5 — CID 171868946
2,3-dihydroxy-3-(3-oxo-4H-1,4-benzoxazin-6-yl)propanamide (PubChem CID 171868946) has the molecular formula C11H12N2O5 and a molecular weight of 252.23 g/mol. Its IUPAC name is 2,3-dihydroxy-3-(3-oxo-4H-1,4-benzoxazin-6-yl)propanamide.
| Compound Name | 2,3-dihydroxy-3-(3-oxo-4H-1,4-benzoxazin-6-yl)propanamide |
|---|---|
| PubChem CID | 171868946 |
| Molecular Formula | C11H12N2O5 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 2,3-dihydroxy-3-(3-oxo-4H-1,4-benzoxazin-6-yl)propanamide |
| SMILES | NC(=O)C(O)C(O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C11H12N2O5/c12-11(17)10(16)9(15)5-1-2-7-6(3-5)13-8(14)4-18-7/h1-3,9-10,15-16H,4H2,(H2,12,17)(H,13,14) |
| InChIKey | KLIYLZKHKYEHET-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |