C12H14N4O4 — CID 171880248
6-(4-azido-1,2-dihydroxybutyl)-4H-1,4-benzoxazin-3-one (PubChem CID 171880248) has the molecular formula C12H14N4O4 and a molecular weight of 278.27 g/mol. Its IUPAC name is 6-(4-azido-1,2-dihydroxybutyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(4-azido-1,2-dihydroxybutyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 171880248 |
| Molecular Formula | C12H14N4O4 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 6-(4-azido-1,2-dihydroxybutyl)-4H-1,4-benzoxazin-3-one |
| SMILES | [N-]=[N+]=NCCC(O)C(O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C12H14N4O4/c13-16-14-4-3-9(17)12(19)7-1-2-10-8(5-7)15-11(18)6-20-10/h1-2,5,9,12,17,19H,3-4,6H2,(H,15,18) |
| InChIKey | OHNUYGOOSGUZHG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 127.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|