C20H22N2O6 — CID 171889208
benzyl N-[3,4-dihydroxy-4-(3-oxo-4H-1,4-benzoxazin-6-yl)butyl]carbamate (PubChem CID 171889208) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is benzyl N-[3,4-dihydroxy-4-(3-oxo-4H-1,4-benzoxazin-6-yl)butyl]carbamate.
| Compound Name | benzyl N-[3,4-dihydroxy-4-(3-oxo-4H-1,4-benzoxazin-6-yl)butyl]carbamate |
|---|---|
| PubChem CID | 171889208 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | benzyl N-[3,4-dihydroxy-4-(3-oxo-4H-1,4-benzoxazin-6-yl)butyl]carbamate |
| SMILES | O=C1COc2ccc(C(O)C(O)CCNC(=O)OCc3ccccc3)cc2N1 |
| InChI | InChI=1S/C20H22N2O6/c23-16(8-9-21-20(26)28-11-13-4-2-1-3-5-13)19(25)14-6-7-17-15(10-14)22-18(24)12-27-17/h1-7,10,16,19,23,25H,8-9,11-12H2,(H,21,26)(H,22,24) |
| InChIKey | XYMMLDCYFOZSRM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |