C10H12N2O3 — CID 66514510
6-[(1S)-1-amino-2-hydroxyethyl]-4H-1,4-benzoxazin-3-one (PubChem CID 66514510) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 6-[(1S)-1-amino-2-hydroxyethyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[(1S)-1-amino-2-hydroxyethyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 66514510 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 6-[(1S)-1-amino-2-hydroxyethyl]-4H-1,4-benzoxazin-3-one |
| SMILES | N[C@H](CO)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C10H12N2O3/c11-7(4-13)6-1-2-9-8(3-6)12-10(14)5-15-9/h1-3,7,13H,4-5,11H2,(H,12,14)/t7-/m1/s1 |
| InChIKey | MQXKYWGWSARYHE-SSDOTTSWSA-N |
| XLogP | 0.01 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |