C11H10F4N2O2 — CID 79660883
6-(1-amino-2,2,3,3-tetrafluoropropyl)-4H-1,4-benzoxazin-3-one (PubChem CID 79660883) has the molecular formula C11H10F4N2O2 and a molecular weight of 278.21 g/mol. Its IUPAC name is 6-(1-amino-2,2,3,3-tetrafluoropropyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(1-amino-2,2,3,3-tetrafluoropropyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 79660883 |
| Molecular Formula | C11H10F4N2O2 |
| Molecular Weight | 278.21 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 6-(1-amino-2,2,3,3-tetrafluoropropyl)-4H-1,4-benzoxazin-3-one |
| SMILES | NC(c1ccc2c(c1)NC(=O)CO2)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H10F4N2O2/c12-10(13)11(14,15)9(16)5-1-2-7-6(3-5)17-8(18)4-19-7/h1-3,9-10H,4,16H2,(H,17,18) |
| InChIKey | QYSOYMUNLKYYHG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|