C12H12F4N2O2 — CID 106289450
6-[(2,2,3,3-tetrafluoropropylamino)methyl]-4H-1,4-benzoxazin-3-one (PubChem CID 106289450) has the molecular formula C12H12F4N2O2 and a molecular weight of 292.23 g/mol. Its IUPAC name is 6-[(2,2,3,3-tetrafluoropropylamino)methyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[(2,2,3,3-tetrafluoropropylamino)methyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 106289450 |
| Molecular Formula | C12H12F4N2O2 |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 6-[(2,2,3,3-tetrafluoropropylamino)methyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(CNCC(F)(F)C(F)F)cc2N1 |
| InChI | InChI=1S/C12H12F4N2O2/c13-11(14)12(15,16)6-17-4-7-1-2-9-8(3-7)18-10(19)5-20-9/h1-3,11,17H,4-6H2,(H,18,19) |
| InChIKey | LYLMMQKYKWNYJH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|