C10H9NO3 — CID 91313215
2-(3-oxo-4H-1,4-benzoxazin-6-yl)acetaldehyde (PubChem CID 91313215) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is 2-(3-oxo-4H-1,4-benzoxazin-6-yl)acetaldehyde.
| Compound Name | 2-(3-oxo-4H-1,4-benzoxazin-6-yl)acetaldehyde |
|---|---|
| PubChem CID | 91313215 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 2-(3-oxo-4H-1,4-benzoxazin-6-yl)acetaldehyde |
| SMILES | O=CCc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C10H9NO3/c12-4-3-7-1-2-9-8(5-7)11-10(13)6-14-9/h1-2,4-5H,3,6H2,(H,11,13) |
| InChIKey | HRZOLQIZWOMHJQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|