C13H17N3O3 — CID 103075401
N-ethyl-2-[(3-oxo-4H-1,4-benzoxazin-6-yl)methylamino]acetamide (PubChem CID 103075401) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is N-ethyl-2-[(3-oxo-4H-1,4-benzoxazin-6-yl)methylamino]acetamide.
| Compound Name | N-ethyl-2-[(3-oxo-4H-1,4-benzoxazin-6-yl)methylamino]acetamide |
|---|---|
| PubChem CID | 103075401 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-ethyl-2-[(3-oxo-4H-1,4-benzoxazin-6-yl)methylamino]acetamide |
| SMILES | CCNC(=O)CNCc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C13H17N3O3/c1-2-15-12(17)7-14-6-9-3-4-11-10(5-9)16-13(18)8-19-11/h3-5,14H,2,6-8H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | SVODZKJABAANFX-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |