C14H16N2O5 — CID 110738387
methyl 4-oxo-4-[(3-oxo-4H-1,4-benzoxazin-6-yl)methylamino]butanoate (PubChem CID 110738387) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is methyl 4-oxo-4-[(3-oxo-4H-1,4-benzoxazin-6-yl)methylamino]butanoate.
| Compound Name | methyl 4-oxo-4-[(3-oxo-4H-1,4-benzoxazin-6-yl)methylamino]butanoate |
|---|---|
| PubChem CID | 110738387 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | methyl 4-oxo-4-[(3-oxo-4H-1,4-benzoxazin-6-yl)methylamino]butanoate |
| SMILES | COC(=O)CCC(=O)NCc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C14H16N2O5/c1-20-14(19)5-4-12(17)15-7-9-2-3-11-10(6-9)16-13(18)8-21-11/h2-3,6H,4-5,7-8H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | ZQSLSFKMYFGZGZ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |