C13H13N3O4S — CID 59802642
2-oxo-N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 59802642) has the molecular formula C13H13N3O4S and a molecular weight of 307.33 g/mol. Its IUPAC name is 2-oxo-N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | 2-oxo-N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 59802642 |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 2-oxo-N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C1COc2ccc(CNC(=O)C3CSC(=O)N3)cc2N1 |
| InChI | InChI=1S/C13H13N3O4S/c17-11-5-20-10-2-1-7(3-8(10)15-11)4-14-12(18)9-6-21-13(19)16-9/h1-3,9H,4-6H2,(H,14,18)(H,15,17)(H,16,19) |
| InChIKey | XYNKJAVLVDOYOY-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|