methyl 2-[(3-oxo-4H-1,4-benzoxazin-6-yl)oxy]acetate

C11H11NO5 — CID 17233891

IUPACmethyl 2-[(3-oxo-4H-1,4-benzoxazin-6-yl)oxy]acetate
SMILESCOC(=O)COc1ccc2c(c1)NC(=O)CO2
InChIInChI=1S/C11H11NO5/c1-15-11(14)6-16-7-2-3-9-8(4-7)12-10(13)5-17-9/h2-4H,5-6H2,1H3,(H,12,13)
InChIKeyBJBONRKSQLAZQO-UHFFFAOYSA-N
MW237.21 g/mol
LogP0.57
Rot. Bonds3

About methyl 2-[(3-oxo-4H-1,4-benzoxazin-6-yl)oxy]acetate

methyl 2-[(3-oxo-4H-1,4-benzoxazin-6-yl)oxy]acetate (PubChem CID 17233891) has the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. Its IUPAC name is methyl 2-[(3-oxo-4H-1,4-benzoxazin-6-yl)oxy]acetate.

Molecular Properties

Compound Namemethyl 2-[(3-oxo-4H-1,4-benzoxazin-6-yl)oxy]acetate
PubChem CID17233891
Molecular FormulaC11H11NO5
Molecular Weight237.21 g/mol
Exact Mass237.06
IUPAC Namemethyl 2-[(3-oxo-4H-1,4-benzoxazin-6-yl)oxy]acetate
SMILESCOC(=O)COc1ccc2c(c1)NC(=O)CO2
InChIInChI=1S/C11H11NO5/c1-15-11(14)6-16-7-2-3-9-8(4-7)12-10(13)5-17-9/h2-4H,5-6H2,1H3,(H,12,13)
InChIKeyBJBONRKSQLAZQO-UHFFFAOYSA-N
XLogP0.57
TPSA73.86 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.21
LogP ≤ 50.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 2-[(3-oxo-4H-1,4-benzoxazin-6-yl)oxy]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(3-oxo-4H-1,4-benzoxazin-6-yl)oxy]acetate?
The IUPAC name of methyl 2-[(3-oxo-4H-1,4-benzoxazin-6-yl)oxy]acetate (CID 17233891) is methyl 2-[(3-oxo-4H-1,4-benzoxazin-6-yl)oxy]acetate.
What is the SMILES notation for methyl 2-[(3-oxo-4H-1,4-benzoxazin-6-yl)oxy]acetate?
The canonical SMILES for methyl 2-[(3-oxo-4H-1,4-benzoxazin-6-yl)oxy]acetate is COC(=O)COc1ccc2c(c1)NC(=O)CO2.
What is the InChIKey of methyl 2-[(3-oxo-4H-1,4-benzoxazin-6-yl)oxy]acetate?
The InChIKey is BJBONRKSQLAZQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO5/c1-15-11(14)6-16-7-2-3-9-8(4-7)12-10(13)5-17-9/h2-4H,5-6H2,1H3,(H,12,13).
What are the key properties of methyl 2-[(3-oxo-4H-1,4-benzoxazin-6-yl)oxy]acetate?
methyl 2-[(3-oxo-4H-1,4-benzoxazin-6-yl)oxy]acetate has a molecular weight of 237.21 g/mol, XLogP of 0.57, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3-oxo-4H-1,4-benzoxazin-6-yl)oxy]acetate is sourced from PubChem (CID 17233891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).