C11H12N2O3 — CID 116954205
2-(methylamino)-2-(3-oxo-4H-1,4-benzoxazin-6-yl)acetaldehyde (PubChem CID 116954205) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 2-(methylamino)-2-(3-oxo-4H-1,4-benzoxazin-6-yl)acetaldehyde.
| Compound Name | 2-(methylamino)-2-(3-oxo-4H-1,4-benzoxazin-6-yl)acetaldehyde |
|---|---|
| PubChem CID | 116954205 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-(methylamino)-2-(3-oxo-4H-1,4-benzoxazin-6-yl)acetaldehyde |
| SMILES | CNC(C=O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C11H12N2O3/c1-12-9(5-14)7-2-3-10-8(4-7)13-11(15)6-16-10/h2-5,9,12H,6H2,1H3,(H,13,15) |
| InChIKey | HLHCKWJAQKKIFT-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|