C13H15F3N2O2 — CID 82028356
6-(1-amino-2,2,2-trifluoroethyl)-4-propyl-1,4-benzoxazin-3-one (PubChem CID 82028356) has the molecular formula C13H15F3N2O2 and a molecular weight of 288.27 g/mol. Its IUPAC name is 6-(1-amino-2,2,2-trifluoroethyl)-4-propyl-1,4-benzoxazin-3-one.
| Compound Name | 6-(1-amino-2,2,2-trifluoroethyl)-4-propyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82028356 |
| Molecular Formula | C13H15F3N2O2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 6-(1-amino-2,2,2-trifluoroethyl)-4-propyl-1,4-benzoxazin-3-one |
| SMILES | CCCN1C(=O)COc2ccc(C(N)C(F)(F)F)cc21 |
| InChI | InChI=1S/C13H15F3N2O2/c1-2-5-18-9-6-8(12(17)13(14,15)16)3-4-10(9)20-7-11(18)19/h3-4,6,12H,2,5,7,17H2,1H3 |
| InChIKey | BEWANTVBFGBTBG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |