C13H19N3O4S — CID 110504184
6-(dimethylsulfamoylamino)-3-oxo-4-propyl-1,4-benzoxazine (PubChem CID 110504184) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is 6-(dimethylsulfamoylamino)-3-oxo-4-propyl-1,4-benzoxazine.
| Compound Name | 6-(dimethylsulfamoylamino)-3-oxo-4-propyl-1,4-benzoxazine |
|---|---|
| PubChem CID | 110504184 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 6-(dimethylsulfamoylamino)-3-oxo-4-propyl-1,4-benzoxazine |
| SMILES | CCCN1C(=O)COc2ccc(NS(=O)(=O)N(C)C)cc21 |
| InChI | InChI=1S/C13H19N3O4S/c1-4-7-16-11-8-10(14-21(18,19)15(2)3)5-6-12(11)20-9-13(16)17/h5-6,8,14H,4,7,9H2,1-3H3 |
| InChIKey | HPBFRGPHGKCYHS-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |