C12H17NO3 — CID 91005222
methanol;4-propyl-1,4-benzoxazin-3-one (PubChem CID 91005222) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is methanol;4-propyl-1,4-benzoxazin-3-one.
| Compound Name | methanol;4-propyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 91005222 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | methanol;4-propyl-1,4-benzoxazin-3-one |
| SMILES | CCCN1C(=O)COc2ccccc21.CO |
| InChI | InChI=1S/C11H13NO2.CH4O/c1-2-7-12-9-5-3-4-6-10(9)14-8-11(12)13;1-2/h3-6H,2,7-8H2,1H3;2H,1H3 |
| InChIKey | YCUZRHLHWCSQRO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |