About 4-(5-hydroxypentyl)-1,4-benzoxazin-3-one
4-(5-hydroxypentyl)-1,4-benzoxazin-3-one (PubChem CID 62229355) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is 4-(5-hydroxypentyl)-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 4-(5-hydroxypentyl)-1,4-benzoxazin-3-one |
| PubChem CID | 62229355 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 4-(5-hydroxypentyl)-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccccc2N1CCCCCO |
| InChI | InChI=1S/C13H17NO3/c15-9-5-1-4-8-14-11-6-2-3-7-12(11)17-10-13(14)16/h2-3,6-7,15H,1,4-5,8-10H2 |
| InChIKey | NPIALOJIWKQWPQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-hydroxypentyl)-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-hydroxypentyl)-1,4-benzoxazin-3-one?
The IUPAC name of 4-(5-hydroxypentyl)-1,4-benzoxazin-3-one (CID 62229355) is 4-(5-hydroxypentyl)-1,4-benzoxazin-3-one.
What is the SMILES notation for 4-(5-hydroxypentyl)-1,4-benzoxazin-3-one?
The canonical SMILES for 4-(5-hydroxypentyl)-1,4-benzoxazin-3-one is O=C1COc2ccccc2N1CCCCCO.
What is the InChIKey of 4-(5-hydroxypentyl)-1,4-benzoxazin-3-one?
The InChIKey is NPIALOJIWKQWPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3/c15-9-5-1-4-8-14-11-6-2-3-7-12(11)17-10-13(14)16/h2-3,6-7,15H,1,4-5,8-10H2.
What are the key properties of 4-(5-hydroxypentyl)-1,4-benzoxazin-3-one?
4-(5-hydroxypentyl)-1,4-benzoxazin-3-one has a molecular weight of 235.28 g/mol, XLogP of 1.57, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-hydroxypentyl)-1,4-benzoxazin-3-one is sourced from PubChem (CID 62229355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).