C13H17NO3 — CID 62229355
4-(5-hydroxypentyl)-1,4-benzoxazin-3-one (PubChem CID 62229355) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 4-(5-hydroxypentyl)-1,4-benzoxazin-3-one.
| Compound Name | 4-(5-hydroxypentyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 62229355 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 4-(5-hydroxypentyl)-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccccc2N1CCCCCO |
| InChI | InChI=1S/C13H17NO3/c15-9-5-1-4-8-14-11-6-2-3-7-12(11)17-10-13(14)16/h2-3,6-7,15H,1,4-5,8-10H2 |
| InChIKey | NPIALOJIWKQWPQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|