C13H16INO4S — CID 106735142
6-iodo-4-(2-propylsulfonylethyl)-1,4-benzoxazin-3-one (PubChem CID 106735142) has the molecular formula C13H16INO4S and a molecular weight of 409.25 g/mol. Its IUPAC name is 6-iodo-4-(2-propylsulfonylethyl)-1,4-benzoxazin-3-one.
| Compound Name | 6-iodo-4-(2-propylsulfonylethyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 106735142 |
| Molecular Formula | C13H16INO4S |
| Molecular Weight | 409.25 g/mol |
| Exact Mass | 408.98 |
| IUPAC Name | 6-iodo-4-(2-propylsulfonylethyl)-1,4-benzoxazin-3-one |
| SMILES | CCCS(=O)(=O)CCN1C(=O)COc2ccc(I)cc21 |
| InChI | InChI=1S/C13H16INO4S/c1-2-6-20(17,18)7-5-15-11-8-10(14)3-4-12(11)19-9-13(15)16/h3-4,8H,2,5-7,9H2,1H3 |
| InChIKey | DCOZIJNLNIUHRF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|