C12H16N2O4S — CID 55154456
7-amino-4-(2-ethylsulfonylethyl)-1,4-benzoxazin-3-one (PubChem CID 55154456) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is 7-amino-4-(2-ethylsulfonylethyl)-1,4-benzoxazin-3-one.
| Compound Name | 7-amino-4-(2-ethylsulfonylethyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 55154456 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 7-amino-4-(2-ethylsulfonylethyl)-1,4-benzoxazin-3-one |
| SMILES | CCS(=O)(=O)CCN1C(=O)COc2cc(N)ccc21 |
| InChI | InChI=1S/C12H16N2O4S/c1-2-19(16,17)6-5-14-10-4-3-9(13)7-11(10)18-8-12(14)15/h3-4,7H,2,5-6,8,13H2,1H3 |
| InChIKey | SWCKZNITDSUBMI-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|