C14H19N3O3 — CID 62988067
4-(7-amino-3-oxo-1,4-benzoxazin-4-yl)-N,N-dimethylbutanamide (PubChem CID 62988067) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 4-(7-amino-3-oxo-1,4-benzoxazin-4-yl)-N,N-dimethylbutanamide.
| Compound Name | 4-(7-amino-3-oxo-1,4-benzoxazin-4-yl)-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 62988067 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 4-(7-amino-3-oxo-1,4-benzoxazin-4-yl)-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCN1C(=O)COc2cc(N)ccc21 |
| InChI | InChI=1S/C14H19N3O3/c1-16(2)13(18)4-3-7-17-11-6-5-10(15)8-12(11)20-9-14(17)19/h5-6,8H,3-4,7,9,15H2,1-2H3 |
| InChIKey | YQHOOQJAWMNRIW-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|