C16H25N3O2 — CID 143919885
7-amino-4-[3-(dimethylamino)hexyl]-1,4-benzoxazin-3-one (PubChem CID 143919885) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is 7-amino-4-[3-(dimethylamino)hexyl]-1,4-benzoxazin-3-one.
| Compound Name | 7-amino-4-[3-(dimethylamino)hexyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 143919885 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 7-amino-4-[3-(dimethylamino)hexyl]-1,4-benzoxazin-3-one |
| SMILES | CCCC(CCN1C(=O)COc2cc(N)ccc21)N(C)C |
| InChI | InChI=1S/C16H25N3O2/c1-4-5-13(18(2)3)8-9-19-14-7-6-12(17)10-15(14)21-11-16(19)20/h6-7,10,13H,4-5,8-9,11,17H2,1-3H3 |
| InChIKey | RSSTUVHXHQHINI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|