C11H12N6O2 — CID 107042833
7-amino-4-[(2-methyltetrazol-5-yl)methyl]-1,4-benzoxazin-3-one (PubChem CID 107042833) has the molecular formula C11H12N6O2 and a molecular weight of 260.26 g/mol. Its IUPAC name is 7-amino-4-[(2-methyltetrazol-5-yl)methyl]-1,4-benzoxazin-3-one.
| Compound Name | 7-amino-4-[(2-methyltetrazol-5-yl)methyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 107042833 |
| Molecular Formula | C11H12N6O2 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 7-amino-4-[(2-methyltetrazol-5-yl)methyl]-1,4-benzoxazin-3-one |
| SMILES | Cn1nnc(CN2C(=O)COc3cc(N)ccc32)n1 |
| InChI | InChI=1S/C11H12N6O2/c1-16-14-10(13-15-16)5-17-8-3-2-7(12)4-9(8)19-6-11(17)18/h2-4H,5-6,12H2,1H3 |
| InChIKey | GDBBWVRZCNKPSZ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|