C15H12Cl2N2O2 — CID 107306378
7-amino-4-[(2,3-dichlorophenyl)methyl]-1,4-benzoxazin-3-one (PubChem CID 107306378) has the molecular formula C15H12Cl2N2O2 and a molecular weight of 323.18 g/mol. Its IUPAC name is 7-amino-4-[(2,3-dichlorophenyl)methyl]-1,4-benzoxazin-3-one.
| Compound Name | 7-amino-4-[(2,3-dichlorophenyl)methyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 107306378 |
| Molecular Formula | C15H12Cl2N2O2 |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 7-amino-4-[(2,3-dichlorophenyl)methyl]-1,4-benzoxazin-3-one |
| SMILES | Nc1ccc2c(c1)OCC(=O)N2Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H12Cl2N2O2/c16-11-3-1-2-9(15(11)17)7-19-12-5-4-10(18)6-13(12)21-8-14(19)20/h1-6H,7-8,18H2 |
| InChIKey | ZPQUQNJWGOXBBU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|