C15H11ClINO2 — CID 79785245
4-[(2-chlorophenyl)methyl]-7-iodo-1,4-benzoxazin-3-one (PubChem CID 79785245) has the molecular formula C15H11ClINO2 and a molecular weight of 399.62 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methyl]-7-iodo-1,4-benzoxazin-3-one.
| Compound Name | 4-[(2-chlorophenyl)methyl]-7-iodo-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 79785245 |
| Molecular Formula | C15H11ClINO2 |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 398.95 |
| IUPAC Name | 4-[(2-chlorophenyl)methyl]-7-iodo-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2cc(I)ccc2N1Cc1ccccc1Cl |
| InChI | InChI=1S/C15H11ClINO2/c16-12-4-2-1-3-10(12)8-18-13-6-5-11(17)7-14(13)20-9-15(18)19/h1-7H,8-9H2 |
| InChIKey | ZFVFIRPECUFCEO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|