C15H10ClFINO2 — CID 103042239
4-[(3-chloro-4-fluorophenyl)methyl]-6-iodo-1,4-benzoxazin-3-one (PubChem CID 103042239) has the molecular formula C15H10ClFINO2 and a molecular weight of 417.61 g/mol. Its IUPAC name is 4-[(3-chloro-4-fluorophenyl)methyl]-6-iodo-1,4-benzoxazin-3-one.
| Compound Name | 4-[(3-chloro-4-fluorophenyl)methyl]-6-iodo-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 103042239 |
| Molecular Formula | C15H10ClFINO2 |
| Molecular Weight | 417.61 g/mol |
| Exact Mass | 416.94 |
| IUPAC Name | 4-[(3-chloro-4-fluorophenyl)methyl]-6-iodo-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(I)cc2N1Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H10ClFINO2/c16-11-5-9(1-3-12(11)17)7-19-13-6-10(18)2-4-14(13)21-8-15(19)20/h1-6H,7-8H2 |
| InChIKey | YBKFJNPBZLCBNE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.61 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|