C16H13BrINO3 — CID 135217687
7-bromo-4-[(4-iodophenyl)methyl]-6-methoxy-1,4-benzoxazin-3-one (PubChem CID 135217687) has the molecular formula C16H13BrINO3 and a molecular weight of 474.09 g/mol. Its IUPAC name is 7-bromo-4-[(4-iodophenyl)methyl]-6-methoxy-1,4-benzoxazin-3-one.
| Compound Name | 7-bromo-4-[(4-iodophenyl)methyl]-6-methoxy-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 135217687 |
| Molecular Formula | C16H13BrINO3 |
| Molecular Weight | 474.09 g/mol |
| Exact Mass | 472.91 |
| IUPAC Name | 7-bromo-4-[(4-iodophenyl)methyl]-6-methoxy-1,4-benzoxazin-3-one |
| SMILES | COc1cc2c(cc1Br)OCC(=O)N2Cc1ccc(I)cc1 |
| InChI | InChI=1S/C16H13BrINO3/c1-21-14-7-13-15(6-12(14)17)22-9-16(20)19(13)8-10-2-4-11(18)5-3-10/h2-7H,8-9H2,1H3 |
| InChIKey | KOZDTFOVEOLBKG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.09 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|