C17H14FNO4 — CID 94761459
4-[(4-fluorophenyl)methyl]-8-methoxy-3-oxo-1,4-benzoxazine-6-carbaldehyde (PubChem CID 94761459) has the molecular formula C17H14FNO4 and a molecular weight of 315.30 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)methyl]-8-methoxy-3-oxo-1,4-benzoxazine-6-carbaldehyde.
| Compound Name | 4-[(4-fluorophenyl)methyl]-8-methoxy-3-oxo-1,4-benzoxazine-6-carbaldehyde |
|---|---|
| PubChem CID | 94761459 |
| Molecular Formula | C17H14FNO4 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 4-[(4-fluorophenyl)methyl]-8-methoxy-3-oxo-1,4-benzoxazine-6-carbaldehyde |
| SMILES | COc1cc(C=O)cc2c1OCC(=O)N2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C17H14FNO4/c1-22-15-7-12(9-20)6-14-17(15)23-10-16(21)19(14)8-11-2-4-13(18)5-3-11/h2-7,9H,8,10H2,1H3 |
| InChIKey | LYSBVODDYBTYKQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|