C18H17NO5 — CID 82156073
4-(2-hydroxyethyl)-3-oxo-8-phenylmethoxy-1,4-benzoxazine-6-carbaldehyde (PubChem CID 82156073) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is 4-(2-hydroxyethyl)-3-oxo-8-phenylmethoxy-1,4-benzoxazine-6-carbaldehyde.
| Compound Name | 4-(2-hydroxyethyl)-3-oxo-8-phenylmethoxy-1,4-benzoxazine-6-carbaldehyde |
|---|---|
| PubChem CID | 82156073 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 4-(2-hydroxyethyl)-3-oxo-8-phenylmethoxy-1,4-benzoxazine-6-carbaldehyde |
| SMILES | O=Cc1cc(OCc2ccccc2)c2c(c1)N(CCO)C(=O)CO2 |
| InChI | InChI=1S/C18H17NO5/c20-7-6-19-15-8-14(10-21)9-16(18(15)24-12-17(19)22)23-11-13-4-2-1-3-5-13/h1-5,8-10,20H,6-7,11-12H2 |
| InChIKey | PBSZUCZUGRJQGR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|