About 4-[(3,5-dimethylphenyl)methyl]-7-iodo-1,4-benzoxazin-3-one
4-[(3,5-dimethylphenyl)methyl]-7-iodo-1,4-benzoxazin-3-one (PubChem CID 79782456) has the molecular formula C17H16INO2
and a molecular weight of 393.22 g/mol. Its IUPAC name is 4-[(3,5-dimethylphenyl)methyl]-7-iodo-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 4-[(3,5-dimethylphenyl)methyl]-7-iodo-1,4-benzoxazin-3-one |
| PubChem CID | 79782456 |
| Molecular Formula | C17H16INO2 |
| Molecular Weight | 393.22 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | 4-[(3,5-dimethylphenyl)methyl]-7-iodo-1,4-benzoxazin-3-one |
| SMILES | Cc1cc(C)cc(CN2C(=O)COc3cc(I)ccc32)c1 |
| InChI | InChI=1S/C17H16INO2/c1-11-5-12(2)7-13(6-11)9-19-15-4-3-14(18)8-16(15)21-10-17(19)20/h3-8H,9-10H2,1-2H3 |
| InChIKey | GXUXHZIPYFEWQG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.22 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3,5-dimethylphenyl)methyl]-7-iodo-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,5-dimethylphenyl)methyl]-7-iodo-1,4-benzoxazin-3-one?
The IUPAC name of 4-[(3,5-dimethylphenyl)methyl]-7-iodo-1,4-benzoxazin-3-one (CID 79782456) is 4-[(3,5-dimethylphenyl)methyl]-7-iodo-1,4-benzoxazin-3-one.
What is the SMILES notation for 4-[(3,5-dimethylphenyl)methyl]-7-iodo-1,4-benzoxazin-3-one?
The canonical SMILES for 4-[(3,5-dimethylphenyl)methyl]-7-iodo-1,4-benzoxazin-3-one is Cc1cc(C)cc(CN2C(=O)COc3cc(I)ccc32)c1.
What is the InChIKey of 4-[(3,5-dimethylphenyl)methyl]-7-iodo-1,4-benzoxazin-3-one?
The InChIKey is GXUXHZIPYFEWQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16INO2/c1-11-5-12(2)7-13(6-11)9-19-15-4-3-14(18)8-16(15)21-10-17(19)20/h3-8H,9-10H2,1-2H3.
What are the key properties of 4-[(3,5-dimethylphenyl)methyl]-7-iodo-1,4-benzoxazin-3-one?
4-[(3,5-dimethylphenyl)methyl]-7-iodo-1,4-benzoxazin-3-one has a molecular weight of 393.22 g/mol, XLogP of 3.83, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,5-dimethylphenyl)methyl]-7-iodo-1,4-benzoxazin-3-one is sourced from PubChem (CID 79782456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).