C14H18INO2 — CID 83163219
7-iodo-4-(4-methylpentyl)-1,4-benzoxazin-3-one (PubChem CID 83163219) has the molecular formula C14H18INO2 and a molecular weight of 359.21 g/mol. Its IUPAC name is 7-iodo-4-(4-methylpentyl)-1,4-benzoxazin-3-one.
| Compound Name | 7-iodo-4-(4-methylpentyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 83163219 |
| Molecular Formula | C14H18INO2 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | 7-iodo-4-(4-methylpentyl)-1,4-benzoxazin-3-one |
| SMILES | CC(C)CCCN1C(=O)COc2cc(I)ccc21 |
| InChI | InChI=1S/C14H18INO2/c1-10(2)4-3-7-16-12-6-5-11(15)8-13(12)18-9-14(16)17/h5-6,8,10H,3-4,7,9H2,1-2H3 |
| InChIKey | PBKWUJPMBAVXJE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|