C14H18FNO2 — CID 53364243
7-fluoro-4-hexyl-1,4-benzoxazin-3-one (PubChem CID 53364243) has the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. Its IUPAC name is 7-fluoro-4-hexyl-1,4-benzoxazin-3-one.
| Compound Name | 7-fluoro-4-hexyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 53364243 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 7-fluoro-4-hexyl-1,4-benzoxazin-3-one |
| SMILES | CCCCCCN1C(=O)COc2cc(F)ccc21 |
| InChI | InChI=1S/C14H18FNO2/c1-2-3-4-5-8-16-12-7-6-11(15)9-13(12)18-10-14(16)17/h6-7,9H,2-5,8,10H2,1H3 |
| InChIKey | XJNSPGSCADSZJZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|