C10H10FNO2 — CID 59525216
4-ethyl-6-fluoro-1,4-benzoxazin-3-one (PubChem CID 59525216) has the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. Its IUPAC name is 4-ethyl-6-fluoro-1,4-benzoxazin-3-one.
| Compound Name | 4-ethyl-6-fluoro-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 59525216 |
| Molecular Formula | C10H10FNO2 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 4-ethyl-6-fluoro-1,4-benzoxazin-3-one |
| SMILES | CCN1C(=O)COc2ccc(F)cc21 |
| InChI | InChI=1S/C10H10FNO2/c1-2-12-8-5-7(11)3-4-9(8)14-6-10(12)13/h3-5H,2,6H2,1H3 |
| InChIKey | BUOPWJMRPXJMME-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |