C11H10FNO4 — CID 26434581
methyl 2-(6-fluoro-3-oxo-1,4-benzoxazin-4-yl)acetate (PubChem CID 26434581) has the molecular formula C11H10FNO4 and a molecular weight of 239.20 g/mol. Its IUPAC name is methyl 2-(6-fluoro-3-oxo-1,4-benzoxazin-4-yl)acetate.
| Compound Name | methyl 2-(6-fluoro-3-oxo-1,4-benzoxazin-4-yl)acetate |
|---|---|
| PubChem CID | 26434581 |
| Molecular Formula | C11H10FNO4 |
| Molecular Weight | 239.20 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | methyl 2-(6-fluoro-3-oxo-1,4-benzoxazin-4-yl)acetate |
| SMILES | COC(=O)CN1C(=O)COc2ccc(F)cc21 |
| InChI | InChI=1S/C11H10FNO4/c1-16-11(15)5-13-8-4-7(12)2-3-9(8)17-6-10(13)14/h2-4H,5-6H2,1H3 |
| InChIKey | AAHIGQLRNSIMNU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.20 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |