methyl 2-(6-fluoro-3-oxo-1,4-benzoxazin-4-yl)acetate

C11H10FNO4 — CID 26434581

IUPACmethyl 2-(6-fluoro-3-oxo-1,4-benzoxazin-4-yl)acetate
SMILESCOC(=O)CN1C(=O)COc2ccc(F)cc21
InChIInChI=1S/C11H10FNO4/c1-16-11(15)5-13-8-4-7(12)2-3-9(8)17-6-10(13)14/h2-4H,5-6H2,1H3
InChIKeyAAHIGQLRNSIMNU-UHFFFAOYSA-N
MW239.20 g/mol
LogP0.72
Rot. Bonds2

About methyl 2-(6-fluoro-3-oxo-1,4-benzoxazin-4-yl)acetate

methyl 2-(6-fluoro-3-oxo-1,4-benzoxazin-4-yl)acetate (PubChem CID 26434581) has the molecular formula C11H10FNO4 and a molecular weight of 239.20 g/mol. Its IUPAC name is methyl 2-(6-fluoro-3-oxo-1,4-benzoxazin-4-yl)acetate.

Molecular Properties

Compound Namemethyl 2-(6-fluoro-3-oxo-1,4-benzoxazin-4-yl)acetate
PubChem CID26434581
Molecular FormulaC11H10FNO4
Molecular Weight239.20 g/mol
Exact Mass239.06
IUPAC Namemethyl 2-(6-fluoro-3-oxo-1,4-benzoxazin-4-yl)acetate
SMILESCOC(=O)CN1C(=O)COc2ccc(F)cc21
InChIInChI=1S/C11H10FNO4/c1-16-11(15)5-13-8-4-7(12)2-3-9(8)17-6-10(13)14/h2-4H,5-6H2,1H3
InChIKeyAAHIGQLRNSIMNU-UHFFFAOYSA-N
XLogP0.72
TPSA55.84 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.20
LogP ≤ 50.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-(6-fluoro-3-oxo-1,4-benzoxazin-4-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(6-fluoro-3-oxo-1,4-benzoxazin-4-yl)acetate?
The IUPAC name of methyl 2-(6-fluoro-3-oxo-1,4-benzoxazin-4-yl)acetate (CID 26434581) is methyl 2-(6-fluoro-3-oxo-1,4-benzoxazin-4-yl)acetate.
What is the SMILES notation for methyl 2-(6-fluoro-3-oxo-1,4-benzoxazin-4-yl)acetate?
The canonical SMILES for methyl 2-(6-fluoro-3-oxo-1,4-benzoxazin-4-yl)acetate is COC(=O)CN1C(=O)COc2ccc(F)cc21.
What is the InChIKey of methyl 2-(6-fluoro-3-oxo-1,4-benzoxazin-4-yl)acetate?
The InChIKey is AAHIGQLRNSIMNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FNO4/c1-16-11(15)5-13-8-4-7(12)2-3-9(8)17-6-10(13)14/h2-4H,5-6H2,1H3.
What are the key properties of methyl 2-(6-fluoro-3-oxo-1,4-benzoxazin-4-yl)acetate?
methyl 2-(6-fluoro-3-oxo-1,4-benzoxazin-4-yl)acetate has a molecular weight of 239.20 g/mol, XLogP of 0.72, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(6-fluoro-3-oxo-1,4-benzoxazin-4-yl)acetate is sourced from PubChem (CID 26434581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).