C12H13NO4 — CID 3154550
methyl 2-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)acetate (PubChem CID 3154550) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is methyl 2-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)acetate.
| Compound Name | methyl 2-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)acetate |
|---|---|
| PubChem CID | 3154550 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | methyl 2-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)acetate |
| SMILES | COC(=O)CN1C(=O)COc2ccc(C)cc21 |
| InChI | InChI=1S/C12H13NO4/c1-8-3-4-10-9(5-8)13(6-12(15)16-2)11(14)7-17-10/h3-5H,6-7H2,1-2H3 |
| InChIKey | PKSQSHWWGHMWOS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |