C17H16N2O3 — CID 18773522
2-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)-N-phenylacetamide (PubChem CID 18773522) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)-N-phenylacetamide.
| Compound Name | 2-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)-N-phenylacetamide |
|---|---|
| PubChem CID | 18773522 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 2-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)-N-phenylacetamide |
| SMILES | Cc1ccc2c(c1)N(CC(=O)Nc1ccccc1)C(=O)CO2 |
| InChI | InChI=1S/C17H16N2O3/c1-12-7-8-15-14(9-12)19(17(21)11-22-15)10-16(20)18-13-5-3-2-4-6-13/h2-9H,10-11H2,1H3,(H,18,20) |
| InChIKey | XPMGHMYBYURTMV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |