C17H16N2O6S — CID 126460552
methyl 2-[3-oxo-7-(phenylsulfamoyl)-1,4-benzoxazin-4-yl]acetate (PubChem CID 126460552) has the molecular formula C17H16N2O6S and a molecular weight of 376.39 g/mol. Its IUPAC name is methyl 2-[3-oxo-7-(phenylsulfamoyl)-1,4-benzoxazin-4-yl]acetate.
| Compound Name | methyl 2-[3-oxo-7-(phenylsulfamoyl)-1,4-benzoxazin-4-yl]acetate |
|---|---|
| PubChem CID | 126460552 |
| Molecular Formula | C17H16N2O6S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | methyl 2-[3-oxo-7-(phenylsulfamoyl)-1,4-benzoxazin-4-yl]acetate |
| SMILES | COC(=O)CN1C(=O)COc2cc(S(=O)(=O)Nc3ccccc3)ccc21 |
| InChI | InChI=1S/C17H16N2O6S/c1-24-17(21)10-19-14-8-7-13(9-15(14)25-11-16(19)20)26(22,23)18-12-5-3-2-4-6-12/h2-9,18H,10-11H2,1H3 |
| InChIKey | UVFNSQXPMDWTNR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |