C18H16ClFN2O4 — CID 37360924
2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-[2-(4-fluorophenoxy)ethyl]acetamide (PubChem CID 37360924) has the molecular formula C18H16ClFN2O4 and a molecular weight of 378.79 g/mol. Its IUPAC name is 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-[2-(4-fluorophenoxy)ethyl]acetamide.
| Compound Name | 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-[2-(4-fluorophenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 37360924 |
| Molecular Formula | C18H16ClFN2O4 |
| Molecular Weight | 378.79 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-[2-(4-fluorophenoxy)ethyl]acetamide |
| SMILES | O=C(CN1C(=O)COc2ccc(Cl)cc21)NCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C18H16ClFN2O4/c19-12-1-6-16-15(9-12)22(18(24)11-26-16)10-17(23)21-7-8-25-14-4-2-13(20)3-5-14/h1-6,9H,7-8,10-11H2,(H,21,23) |
| InChIKey | BIJYPHFXCKEVJN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.79 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|