C10H7Cl2NO3 — CID 6494233
2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl chloride (PubChem CID 6494233) has the molecular formula C10H7Cl2NO3 and a molecular weight of 260.08 g/mol. Its IUPAC name is 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl chloride.
| Compound Name | 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl chloride |
|---|---|
| PubChem CID | 6494233 |
| Molecular Formula | C10H7Cl2NO3 |
| Molecular Weight | 260.08 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl chloride |
| SMILES | O=C(Cl)CN1C(=O)COc2ccc(Cl)cc21 |
| InChI | InChI=1S/C10H7Cl2NO3/c11-6-1-2-8-7(3-6)13(4-9(12)14)10(15)5-16-8/h1-3H,4-5H2 |
| InChIKey | WBJWATHENOURRB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.08 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|