2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl chloride

C10H7Cl2NO3 — CID 6494233

IUPAC2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl chloride
SMILESO=C(Cl)CN1C(=O)COc2ccc(Cl)cc21
InChIInChI=1S/C10H7Cl2NO3/c11-6-1-2-8-7(3-6)13(4-9(12)14)10(15)5-16-8/h1-3H,4-5H2
InChIKeyWBJWATHENOURRB-UHFFFAOYSA-N
MW260.08 g/mol
LogP1.83
Rot. Bonds2

About 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl chloride

2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl chloride (PubChem CID 6494233) has the molecular formula C10H7Cl2NO3 and a molecular weight of 260.08 g/mol. Its IUPAC name is 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl chloride.

Molecular Properties

Compound Name2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl chloride
PubChem CID6494233
Molecular FormulaC10H7Cl2NO3
Molecular Weight260.08 g/mol
Exact Mass258.98
IUPAC Name2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl chloride
SMILESO=C(Cl)CN1C(=O)COc2ccc(Cl)cc21
InChIInChI=1S/C10H7Cl2NO3/c11-6-1-2-8-7(3-6)13(4-9(12)14)10(15)5-16-8/h1-3H,4-5H2
InChIKeyWBJWATHENOURRB-UHFFFAOYSA-N
XLogP1.83
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.08
LogP ≤ 51.83
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl chloride?
The IUPAC name of 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl chloride (CID 6494233) is 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl chloride.
What is the SMILES notation for 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl chloride?
The canonical SMILES for 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl chloride is O=C(Cl)CN1C(=O)COc2ccc(Cl)cc21.
What is the InChIKey of 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl chloride?
The InChIKey is WBJWATHENOURRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Cl2NO3/c11-6-1-2-8-7(3-6)13(4-9(12)14)10(15)5-16-8/h1-3H,4-5H2.
What are the key properties of 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl chloride?
2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl chloride has a molecular weight of 260.08 g/mol, XLogP of 1.83, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl chloride is sourced from PubChem (CID 6494233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).