C12H12ClNO4 — CID 6473219
4-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)butanoic acid (PubChem CID 6473219) has the molecular formula C12H12ClNO4 and a molecular weight of 269.68 g/mol. Its IUPAC name is 4-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)butanoic acid.
| Compound Name | 4-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)butanoic acid |
|---|---|
| PubChem CID | 6473219 |
| Molecular Formula | C12H12ClNO4 |
| Molecular Weight | 269.68 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 4-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)COc2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H12ClNO4/c13-8-3-4-10-9(6-8)14(11(15)7-18-10)5-1-2-12(16)17/h3-4,6H,1-2,5,7H2,(H,16,17) |
| InChIKey | QYJGGWNTNXRIBA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.68 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |