C11H13ClN2O2 — CID 61388107
6-chloro-4-[2-(methylamino)ethyl]-1,4-benzoxazin-3-one (PubChem CID 61388107) has the molecular formula C11H13ClN2O2 and a molecular weight of 240.69 g/mol. Its IUPAC name is 6-chloro-4-[2-(methylamino)ethyl]-1,4-benzoxazin-3-one.
| Compound Name | 6-chloro-4-[2-(methylamino)ethyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 61388107 |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 6-chloro-4-[2-(methylamino)ethyl]-1,4-benzoxazin-3-one |
| SMILES | CNCCN1C(=O)COc2ccc(Cl)cc21 |
| InChI | InChI=1S/C11H13ClN2O2/c1-13-4-5-14-9-6-8(12)2-3-10(9)16-7-11(14)15/h2-3,6,13H,4-5,7H2,1H3 |
| InChIKey | XQEJZSZNYOTHLD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |