C26H31Cl2N3O5 — CID 57467408
4-[6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3-oxo-1,4-benzoxazin-4-yl]butanoic acid (PubChem CID 57467408) has the molecular formula C26H31Cl2N3O5 and a molecular weight of 536.46 g/mol. Its IUPAC name is 4-[6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3-oxo-1,4-benzoxazin-4-yl]butanoic acid.
| Compound Name | 4-[6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3-oxo-1,4-benzoxazin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 57467408 |
| Molecular Formula | C26H31Cl2N3O5 |
| Molecular Weight | 536.46 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | 4-[6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3-oxo-1,4-benzoxazin-4-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)COc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc21 |
| InChI | InChI=1S/C26H31Cl2N3O5/c27-20-5-3-6-21(26(20)28)30-14-12-29(13-15-30)10-1-2-16-35-19-8-9-23-22(17-19)31(24(32)18-36-23)11-4-7-25(33)34/h3,5-6,8-9,17H,1-2,4,7,10-16,18H2,(H,33,34) |
| InChIKey | GBDLSEXKXHUFEB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|