C27H35Cl2N4O4P — CID 130432389
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl N-methyl-N-methylphosphanylcarbamate (PubChem CID 130432389) has the molecular formula C27H35Cl2N4O4P and a molecular weight of 581.48 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl N-methyl-N-methylphosphanylcarbamate.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl N-methyl-N-methylphosphanylcarbamate |
|---|---|
| PubChem CID | 130432389 |
| Molecular Formula | C27H35Cl2N4O4P |
| Molecular Weight | 581.48 g/mol |
| Exact Mass | 580.18 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl N-methyl-N-methylphosphanylcarbamate |
| SMILES | CPN(C)C(=O)OCN1C(=O)CCc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc21 |
| InChI | InChI=1S/C27H35Cl2N4O4P/c1-30(38-2)27(35)37-19-33-24-18-21(10-8-20(24)9-11-25(33)34)36-17-4-3-12-31-13-15-32(16-14-31)23-7-5-6-22(28)26(23)29/h5-8,10,18,38H,3-4,9,11-17,19H2,1-2H3 |
| InChIKey | VCSDUBASSKYEKU-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 65.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.48 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|