C36H51Cl2N3O5 — CID 138486437
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl 3,3,5-trimethyloctyl carbonate (PubChem CID 138486437) has the molecular formula C36H51Cl2N3O5 and a molecular weight of 676.73 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl 3,3,5-trimethyloctyl carbonate.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl 3,3,5-trimethyloctyl carbonate |
|---|---|
| PubChem CID | 138486437 |
| Molecular Formula | C36H51Cl2N3O5 |
| Molecular Weight | 676.73 g/mol |
| Exact Mass | 675.32 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl 3,3,5-trimethyloctyl carbonate |
| SMILES | CCCC(C)CC(C)(C)CCOC(=O)OCN1C(=O)CCc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc21 |
| InChI | InChI=1S/C36H51Cl2N3O5/c1-5-9-27(2)25-36(3,4)16-23-45-35(43)46-26-41-32-24-29(14-12-28(32)13-15-33(41)42)44-22-7-6-17-39-18-20-40(21-19-39)31-11-8-10-30(37)34(31)38/h8,10-12,14,24,27H,5-7,9,13,15-23,25-26H2,1-4H3 |
| InChIKey | DNKLDDRWBYTAJL-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.73 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|