C28H35Cl2N3O4 — CID 164995367
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl] 2-methylbutanoate (PubChem CID 164995367) has the molecular formula C28H35Cl2N3O4 and a molecular weight of 548.51 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl] 2-methylbutanoate.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 164995367 |
| Molecular Formula | C28H35Cl2N3O4 |
| Molecular Weight | 548.51 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)ON1C(=O)CCc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc21 |
| InChI | InChI=1S/C28H35Cl2N3O4/c1-3-20(2)28(35)37-33-25-19-22(11-9-21(25)10-12-26(33)34)36-18-5-4-13-31-14-16-32(17-15-31)24-8-6-7-23(29)27(24)30/h6-9,11,19-20H,3-5,10,12-18H2,1-2H3 |
| InChIKey | HMCGVGZSTJXEJA-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.51 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|