C30H40ClN3O4 — CID 155107928
[7-[4-[4-(2-chloro-3-methylphenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl 2-methylbutanoate (PubChem CID 155107928) has the molecular formula C30H40ClN3O4 and a molecular weight of 542.12 g/mol. Its IUPAC name is [7-[4-[4-(2-chloro-3-methylphenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl 2-methylbutanoate.
| Compound Name | [7-[4-[4-(2-chloro-3-methylphenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl 2-methylbutanoate |
|---|---|
| PubChem CID | 155107928 |
| Molecular Formula | C30H40ClN3O4 |
| Molecular Weight | 542.12 g/mol |
| Exact Mass | 541.27 |
| IUPAC Name | [7-[4-[4-(2-chloro-3-methylphenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCN1C(=O)CCc2ccc(OCCCCN3CCN(c4cccc(C)c4Cl)CC3)cc21 |
| InChI | InChI=1S/C30H40ClN3O4/c1-4-22(2)30(36)38-21-34-27-20-25(12-10-24(27)11-13-28(34)35)37-19-6-5-14-32-15-17-33(18-16-32)26-9-7-8-23(3)29(26)31/h7-10,12,20,22H,4-6,11,13-19,21H2,1-3H3 |
| InChIKey | MYJQADJTROXENA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.12 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|