C26H31Cl2N3O3 — CID 176723102
3-[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]propanal (PubChem CID 176723102) has the molecular formula C26H31Cl2N3O3 and a molecular weight of 504.46 g/mol. Its IUPAC name is 3-[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]propanal.
| Compound Name | 3-[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]propanal |
|---|---|
| PubChem CID | 176723102 |
| Molecular Formula | C26H31Cl2N3O3 |
| Molecular Weight | 504.46 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | 3-[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]propanal |
| SMILES | O=CCCN1C(=O)CCc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc21 |
| InChI | InChI=1S/C26H31Cl2N3O3/c27-22-5-3-6-23(26(22)28)30-15-13-29(14-16-30)11-1-2-18-34-21-9-7-20-8-10-25(33)31(12-4-17-32)24(20)19-21/h3,5-7,9,17,19H,1-2,4,8,10-16,18H2 |
| InChIKey | XRXHDJJUMANSIO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|