C24H30Cl2N4O2 — CID 123853896
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-imino-3,4-dihydroquinolin-1-yl]methanol (PubChem CID 123853896) has the molecular formula C24H30Cl2N4O2 and a molecular weight of 477.44 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-imino-3,4-dihydroquinolin-1-yl]methanol.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-imino-3,4-dihydroquinolin-1-yl]methanol |
|---|---|
| PubChem CID | 123853896 |
| Molecular Formula | C24H30Cl2N4O2 |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-imino-3,4-dihydroquinolin-1-yl]methanol |
| SMILES | [H]/N=C1\CCc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc2N1CO |
| InChI | InChI=1S/C24H30Cl2N4O2/c25-20-4-3-5-21(24(20)26)29-13-11-28(12-14-29)10-1-2-15-32-19-8-6-18-7-9-23(27)30(17-31)22(18)16-19/h3-6,8,16,27,31H,1-2,7,9-15,17H2/b27-23+ |
| InChIKey | KWIUHKKBIWIDGC-SLEBQGDGSA-N |
| XLogP | 4.65 |
| TPSA | 63.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|