C30H39Cl2N3O4 — CID 50906164
1-[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]ethyl 3-methylbutanoate (PubChem CID 50906164) has the molecular formula C30H39Cl2N3O4 and a molecular weight of 576.57 g/mol. Its IUPAC name is 1-[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]ethyl 3-methylbutanoate.
| Compound Name | 1-[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]ethyl 3-methylbutanoate |
|---|---|
| PubChem CID | 50906164 |
| Molecular Formula | C30H39Cl2N3O4 |
| Molecular Weight | 576.57 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | 1-[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]ethyl 3-methylbutanoate |
| SMILES | CC(C)CC(=O)OC(C)N1C(=O)CCc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc21 |
| InChI | InChI=1S/C30H39Cl2N3O4/c1-21(2)19-29(37)39-22(3)35-27-20-24(11-9-23(27)10-12-28(35)36)38-18-5-4-13-33-14-16-34(17-15-33)26-8-6-7-25(31)30(26)32/h6-9,11,20-22H,4-5,10,12-19H2,1-3H3 |
| InChIKey | GJCGFMFVKAVOGC-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.57 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|