C36H51Cl2N3O4 — CID 129131621
[1-[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]-2-methylpropyl] 2,2,4,4-tetramethylpentanoate (PubChem CID 129131621) has the molecular formula C36H51Cl2N3O4 and a molecular weight of 660.73 g/mol. Its IUPAC name is [1-[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]-2-methylpropyl] 2,2,4,4-tetramethylpentanoate.
| Compound Name | [1-[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]-2-methylpropyl] 2,2,4,4-tetramethylpentanoate |
|---|---|
| PubChem CID | 129131621 |
| Molecular Formula | C36H51Cl2N3O4 |
| Molecular Weight | 660.73 g/mol |
| Exact Mass | 659.33 |
| IUPAC Name | [1-[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]-2-methylpropyl] 2,2,4,4-tetramethylpentanoate |
| SMILES | CC(C)C(OC(=O)C(C)(C)CC(C)(C)C)N1C(=O)CCc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc21 |
| InChI | InChI=1S/C36H51Cl2N3O4/c1-25(2)33(45-34(43)36(6,7)24-35(3,4)5)41-30-23-27(15-13-26(30)14-16-31(41)42)44-22-9-8-17-39-18-20-40(21-19-39)29-12-10-11-28(37)32(29)38/h10-13,15,23,25,33H,8-9,14,16-22,24H2,1-7H3 |
| InChIKey | ORZBDAOGXOAWRA-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.73 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|